C29H24N4O4 — CID 42743449
[2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methyl-3-nitrobenzoate (PubChem CID 42743449) has the molecular formula C29H24N4O4 and a molecular weight of 492.54 g/mol. Its IUPAC name is [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 42743449 |
| Molecular Formula | C29H24N4O4 |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [2-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3ccccc3OC(=O)c3ccc(C)c([N+](=O)[O-])c3)nc2c1 |
| InChI | InChI=1S/C29H24N4O4/c1-19-14-15-32-26(16-19)31-27(28(32)30-18-21-8-4-3-5-9-21)23-10-6-7-11-25(23)37-29(34)22-13-12-20(2)24(17-22)33(35)36/h3-17,30H,18H2,1-2H3 |
| InChIKey | QMSHHPWLXLLQMT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|