C30H25N3O2 — CID 4637314
[3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4637314) has the molecular formula C30H25N3O2 and a molecular weight of 459.55 g/mol. Its IUPAC name is [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4637314 |
| Molecular Formula | C30H25N3O2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)C=Cc4ccccc4)c3)nc2c1 |
| InChI | InChI=1S/C30H25N3O2/c1-22-17-18-33-27(19-22)32-29(30(33)31-21-24-11-6-3-7-12-24)25-13-8-14-26(20-25)35-28(34)16-15-23-9-4-2-5-10-23/h2-20,31H,21H2,1H3 |
| InChIKey | MTOXSJNFQJLVPI-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|