C27H27N3O4 — CID 4990255
4-O-[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 1-O-ethyl butanedioate (PubChem CID 4990255) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is 4-O-[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 1-O-ethyl butanedioate.
| Compound Name | 4-O-[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 1-O-ethyl butanedioate |
|---|---|
| PubChem CID | 4990255 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | 4-O-[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 1-O-ethyl butanedioate |
| SMILES | CCOC(=O)CCC(=O)Oc1cccc(-c2nc3c(C)cccn3c2NCc2ccccc2)c1 |
| InChI | InChI=1S/C27H27N3O4/c1-3-33-23(31)14-15-24(32)34-22-13-7-12-21(17-22)25-27(28-18-20-10-5-4-6-11-20)30-16-8-9-19(2)26(30)29-25/h4-13,16-17,28H,3,14-15,18H2,1-2H3 |
| InChIKey | RHGCIMUPVHACQS-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|