C27H23N3O2S — CID 4683603
[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-thiophen-2-ylacetate (PubChem CID 4683603) has the molecular formula C27H23N3O2S and a molecular weight of 453.57 g/mol. Its IUPAC name is [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-thiophen-2-ylacetate.
| Compound Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-thiophen-2-ylacetate |
|---|---|
| PubChem CID | 4683603 |
| Molecular Formula | C27H23N3O2S |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-thiophen-2-ylacetate |
| SMILES | Cc1cccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)Cc4cccs4)c3)nc12 |
| InChI | InChI=1S/C27H23N3O2S/c1-19-8-6-14-30-26(19)29-25(27(30)28-18-20-9-3-2-4-10-20)21-11-5-12-22(16-21)32-24(31)17-23-13-7-15-33-23/h2-16,28H,17-18H2,1H3 |
| InChIKey | RDTLDBODXDXHCQ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|