C26H27N3O2 — CID 42743732
[2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-dimethylpropanoate (PubChem CID 42743732) has the molecular formula C26H27N3O2 and a molecular weight of 413.52 g/mol. Its IUPAC name is [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-dimethylpropanoate.
| Compound Name | [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 42743732 |
| Molecular Formula | C26H27N3O2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,2-dimethylpropanoate |
| SMILES | Cc1cccn2c(NCc3ccccc3)c(-c3ccccc3OC(=O)C(C)(C)C)nc12 |
| InChI | InChI=1S/C26H27N3O2/c1-18-11-10-16-29-23(18)28-22(24(29)27-17-19-12-6-5-7-13-19)20-14-8-9-15-21(20)31-25(30)26(2,3)4/h5-16,27H,17H2,1-4H3 |
| InChIKey | DSWZMDPSVYTYCD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|