C30H27N3O4 — CID 3994721
[2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate (PubChem CID 3994721) has the molecular formula C30H27N3O4 and a molecular weight of 493.56 g/mol. Its IUPAC name is [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 3994721 |
| Molecular Formula | C30H27N3O4 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | [2-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccccc2-c2nc3c(C)cccn3c2NCc2ccccc2)c1 |
| InChI | InChI=1S/C30H27N3O4/c1-20-10-9-15-33-28(20)32-27(29(33)31-19-21-11-5-4-6-12-21)25-13-7-8-14-26(25)37-30(34)22-16-23(35-2)18-24(17-22)36-3/h4-18,31H,19H2,1-3H3 |
| InChIKey | KEHBMCLYUYHXGZ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|