C28H31N3O2 — CID 4253763
[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] heptanoate (PubChem CID 4253763) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] heptanoate.
| Compound Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] heptanoate |
|---|---|
| PubChem CID | 4253763 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] heptanoate |
| SMILES | CCCCCCC(=O)Oc1cccc(-c2nc3c(C)cccn3c2NCc2ccccc2)c1 |
| InChI | InChI=1S/C28H31N3O2/c1-3-4-5-9-17-25(32)33-24-16-10-15-23(19-24)26-28(29-20-22-13-7-6-8-14-22)31-18-11-12-21(2)27(31)30-26/h6-8,10-16,18-19,29H,3-5,9,17,20H2,1-2H3 |
| InChIKey | RQXDYZVJKYVLME-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|