C26H25N3O4 — CID 42742883
[3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate (PubChem CID 42742883) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate.
| Compound Name | [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate |
|---|---|
| PubChem CID | 42742883 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate |
| SMILES | CCOC(=O)CNc1c(-c2cccc(OC(=O)Cc3ccccc3)c2)nc2cc(C)ccn12 |
| InChI | InChI=1S/C26H25N3O4/c1-3-32-24(31)17-27-26-25(28-22-14-18(2)12-13-29(22)26)20-10-7-11-21(16-20)33-23(30)15-19-8-5-4-6-9-19/h4-14,16,27H,3,15,17H2,1-2H3 |
| InChIKey | NGBKQPCJYKKFKH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|