About [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate
[3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate (PubChem CID 42742883) has the molecular formula C26H25N3O4
and a molecular weight of 443.50 g/mol. Its IUPAC name is [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate.
Molecular Properties
| Compound Name | [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate |
| PubChem CID | 42742883 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate |
| SMILES | CCOC(=O)CNc1c(-c2cccc(OC(=O)Cc3ccccc3)c2)nc2cc(C)ccn12 |
| InChI | InChI=1S/C26H25N3O4/c1-3-32-24(31)17-27-26-25(28-22-14-18(2)12-13-29(22)26)20-10-7-11-21(16-20)33-23(30)15-19-8-5-4-6-9-19/h4-14,16,27H,3,15,17H2,1-2H3 |
| InChIKey | NGBKQPCJYKKFKH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate?
The IUPAC name of [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate (CID 42742883) is [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate.
What is the SMILES notation for [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate?
The canonical SMILES for [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate is CCOC(=O)CNc1c(-c2cccc(OC(=O)Cc3ccccc3)c2)nc2cc(C)ccn12.
What is the InChIKey of [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate?
The InChIKey is NGBKQPCJYKKFKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O4/c1-3-32-24(31)17-27-26-25(28-22-14-18(2)12-13-29(22)26)20-10-7-11-21(16-20)33-23(30)15-19-8-5-4-6-9-19/h4-14,16,27H,3,15,17H2,1-2H3.
What are the key properties of [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate?
[3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate has a molecular weight of 443.50 g/mol, XLogP of 4.43, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-[(2-ethoxy-2-oxoethyl)amino]-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-phenylacetate is sourced from PubChem (CID 42742883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).