C26H27N3O3 — CID 5027401
[3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzoate (PubChem CID 5027401) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzoate.
| Compound Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 5027401 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2cccc(-c3nc4cc(C)ccn4c3NC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-17-13-14-29-22(15-17)27-23(24(29)28-26(2,3)4)19-7-6-8-21(16-19)32-25(30)18-9-11-20(31-5)12-10-18/h6-16,28H,1-5H3 |
| InChIKey | MWPBFGASQNLOGA-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|