C29H27N3O2 — CID 3276136
[3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-carboxylate (PubChem CID 3276136) has the molecular formula C29H27N3O2 and a molecular weight of 449.55 g/mol. Its IUPAC name is [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-carboxylate.
| Compound Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-carboxylate |
|---|---|
| PubChem CID | 3276136 |
| Molecular Formula | C29H27N3O2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-carboxylate |
| SMILES | Cc1ccn2c(NC(C)(C)C)c(-c3cccc(OC(=O)c4ccc5ccccc5c4)c3)nc2c1 |
| InChI | InChI=1S/C29H27N3O2/c1-19-14-15-32-25(16-19)30-26(27(32)31-29(2,3)4)22-10-7-11-24(18-22)34-28(33)23-13-12-20-8-5-6-9-21(20)17-23/h5-18,31H,1-4H3 |
| InChIKey | HZRMBEIVEUIIHI-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|