C26H26ClN3O2 — CID 3931184
[3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-chloro-2,2-dimethylpropanoate (PubChem CID 3931184) has the molecular formula C26H26ClN3O2 and a molecular weight of 447.97 g/mol. Its IUPAC name is [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-chloro-2,2-dimethylpropanoate.
| Compound Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-chloro-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 3931184 |
| Molecular Formula | C26H26ClN3O2 |
| Molecular Weight | 447.97 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-chloro-2,2-dimethylpropanoate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)C(C)(C)CCl)c3)nc2c1 |
| InChI | InChI=1S/C26H26ClN3O2/c1-18-12-13-30-22(14-18)29-23(24(30)28-16-19-8-5-4-6-9-19)20-10-7-11-21(15-20)32-25(31)26(2,3)17-27/h4-15,28H,16-17H2,1-3H3 |
| InChIKey | FASCLVIBJZHGCW-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.97 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|