C29H24ClN3O3 — CID 42743439
[3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-(4-chlorophenoxy)acetate (PubChem CID 42743439) has the molecular formula C29H24ClN3O3 and a molecular weight of 497.98 g/mol. Its IUPAC name is [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-(4-chlorophenoxy)acetate.
| Compound Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-(4-chlorophenoxy)acetate |
|---|---|
| PubChem CID | 42743439 |
| Molecular Formula | C29H24ClN3O3 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.15 |
| IUPAC Name | [3-[3-(benzylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2-(4-chlorophenoxy)acetate |
| SMILES | Cc1ccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)COc4ccc(Cl)cc4)c3)nc2c1 |
| InChI | InChI=1S/C29H24ClN3O3/c1-20-14-15-33-26(16-20)32-28(29(33)31-18-21-6-3-2-4-7-21)22-8-5-9-25(17-22)36-27(34)19-35-24-12-10-23(30)11-13-24/h2-17,31H,18-19H2,1H3 |
| InChIKey | XJBFHLPXBIRIDD-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|