C24H23ClN4O5S — CID 3988232
[3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate (PubChem CID 3988232) has the molecular formula C24H23ClN4O5S and a molecular weight of 514.99 g/mol. Its IUPAC name is [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate.
| Compound Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3988232 |
| Molecular Formula | C24H23ClN4O5S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.11 |
| IUPAC Name | [3-[3-(tert-butylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
| SMILES | Cc1ccn2c(NC(C)(C)C)c(-c3cccc(OS(=O)(=O)c4ccc(Cl)c([N+](=O)[O-])c4)c3)nc2c1 |
| InChI | InChI=1S/C24H23ClN4O5S/c1-15-10-11-28-21(12-15)26-22(23(28)27-24(2,3)4)16-6-5-7-17(13-16)34-35(32,33)18-8-9-19(25)20(14-18)29(30)31/h5-14,27H,1-4H3 |
| InChIKey | SAVRHDCFJOHZPK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|