C23H22ClN3O3S — CID 3536356
[3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzenesulfonate (PubChem CID 3536356) has the molecular formula C23H22ClN3O3S and a molecular weight of 455.97 g/mol. Its IUPAC name is [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzenesulfonate.
| Compound Name | [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 3536356 |
| Molecular Formula | C23H22ClN3O3S |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzenesulfonate |
| SMILES | CC(C)(C)Nc1c(-c2cccc(OS(=O)(=O)c3ccc(Cl)cc3)c2)nc2ccccn12 |
| InChI | InChI=1S/C23H22ClN3O3S/c1-23(2,3)26-22-21(25-20-9-4-5-14-27(20)22)16-7-6-8-18(15-16)30-31(28,29)19-12-10-17(24)11-13-19/h4-15,26H,1-3H3 |
| InChIKey | MJYSDNAZNJMZBV-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|