C26H21F6N3O2 — CID 4042450
[3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-bis(trifluoromethyl)benzoate (PubChem CID 4042450) has the molecular formula C26H21F6N3O2 and a molecular weight of 521.46 g/mol. Its IUPAC name is [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 4042450 |
| Molecular Formula | C26H21F6N3O2 |
| Molecular Weight | 521.46 g/mol |
| Exact Mass | 521.15 |
| IUPAC Name | [3-[3-(tert-butylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-bis(trifluoromethyl)benzoate |
| SMILES | CC(C)(C)Nc1c(-c2cccc(OC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)c2)nc2ccccn12 |
| InChI | InChI=1S/C26H21F6N3O2/c1-24(2,3)34-22-21(33-20-9-4-5-10-35(20)22)15-7-6-8-19(13-15)37-23(36)16-11-17(25(27,28)29)14-18(12-16)26(30,31)32/h4-14,34H,1-3H3 |
| InChIKey | NVLMMRABTWMNNC-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.46 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|