C31H37N3O5 — CID 3958228
[2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate (PubChem CID 3958228) has the molecular formula C31H37N3O5 and a molecular weight of 531.65 g/mol. Its IUPAC name is [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate.
| Compound Name | [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 3958228 |
| Molecular Formula | C31H37N3O5 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.27 |
| IUPAC Name | [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)cc(C(=O)Oc2ccc(-c3nc4ccccn4c3NC(C)(C)CC(C)(C)C)cc2OC)c1 |
| InChI | InChI=1S/C31H37N3O5/c1-30(2,3)19-31(4,5)33-28-27(32-26-11-9-10-14-34(26)28)20-12-13-24(25(17-20)38-8)39-29(35)21-15-22(36-6)18-23(16-21)37-7/h9-18,33H,19H2,1-8H3 |
| InChIKey | RIRFVHUEQFSWPC-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|