C29H31BrFN3O3 — CID 42658934
[4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 2-fluorobenzoate (PubChem CID 42658934) has the molecular formula C29H31BrFN3O3 and a molecular weight of 568.49 g/mol. Its IUPAC name is [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 2-fluorobenzoate.
| Compound Name | [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 42658934 |
| Molecular Formula | C29H31BrFN3O3 |
| Molecular Weight | 568.49 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 2-fluorobenzoate |
| SMILES | COc1cc(-c2nc3ccc(Br)cn3c2NC(C)(C)CC(C)(C)C)ccc1OC(=O)c1ccccc1F |
| InChI | InChI=1S/C29H31BrFN3O3/c1-28(2,3)17-29(4,5)33-26-25(32-24-14-12-19(30)16-34(24)26)18-11-13-22(23(15-18)36-6)37-27(35)20-9-7-8-10-21(20)31/h7-16,33H,17H2,1-6H3 |
| InChIKey | IXRSFXXFQAQHEY-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.49 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|