C27H26BrN3O6 — CID 42742881
ethyl 2-[[6-bromo-2-[3-methoxy-4-(2-phenylmethoxyacetyl)oxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate (PubChem CID 42742881) has the molecular formula C27H26BrN3O6 and a molecular weight of 568.42 g/mol. Its IUPAC name is ethyl 2-[[6-bromo-2-[3-methoxy-4-(2-phenylmethoxyacetyl)oxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate.
| Compound Name | ethyl 2-[[6-bromo-2-[3-methoxy-4-(2-phenylmethoxyacetyl)oxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate |
|---|---|
| PubChem CID | 42742881 |
| Molecular Formula | C27H26BrN3O6 |
| Molecular Weight | 568.42 g/mol |
| Exact Mass | 567.10 |
| IUPAC Name | ethyl 2-[[6-bromo-2-[3-methoxy-4-(2-phenylmethoxyacetyl)oxyphenyl]imidazo[1,2-a]pyridin-3-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1c(-c2ccc(OC(=O)COCc3ccccc3)c(OC)c2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C27H26BrN3O6/c1-3-36-24(32)14-29-27-26(30-23-12-10-20(28)15-31(23)27)19-9-11-21(22(13-19)34-2)37-25(33)17-35-16-18-7-5-4-6-8-18/h4-13,15,29H,3,14,16-17H2,1-2H3 |
| InChIKey | NLKTXINVILZXKD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|