C26H24BrN3O6 — CID 42742879
[4-[6-bromo-3-[(2-ethoxy-2-oxoethyl)amino]imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 3-methoxybenzoate (PubChem CID 42742879) has the molecular formula C26H24BrN3O6 and a molecular weight of 554.40 g/mol. Its IUPAC name is [4-[6-bromo-3-[(2-ethoxy-2-oxoethyl)amino]imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 3-methoxybenzoate.
| Compound Name | [4-[6-bromo-3-[(2-ethoxy-2-oxoethyl)amino]imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 42742879 |
| Molecular Formula | C26H24BrN3O6 |
| Molecular Weight | 554.40 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | [4-[6-bromo-3-[(2-ethoxy-2-oxoethyl)amino]imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 3-methoxybenzoate |
| SMILES | CCOC(=O)CNc1c(-c2ccc(OC(=O)c3cccc(OC)c3)c(OC)c2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C26H24BrN3O6/c1-4-35-23(31)14-28-25-24(29-22-11-9-18(27)15-30(22)25)16-8-10-20(21(13-16)34-3)36-26(32)17-6-5-7-19(12-17)33-2/h5-13,15,28H,4,14H2,1-3H3 |
| InChIKey | WFUKZILUEACOTI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.40 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|