C28H29BrFN3O2 — CID 5038944
[4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-fluorobenzoate (PubChem CID 5038944) has the molecular formula C28H29BrFN3O2 and a molecular weight of 538.46 g/mol. Its IUPAC name is [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-fluorobenzoate.
| Compound Name | [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-fluorobenzoate |
|---|---|
| PubChem CID | 5038944 |
| Molecular Formula | C28H29BrFN3O2 |
| Molecular Weight | 538.46 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | [4-[6-bromo-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-fluorobenzoate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccc(OC(=O)c3ccccc3F)cc2)nc2ccc(Br)cn12 |
| InChI | InChI=1S/C28H29BrFN3O2/c1-27(2,3)17-28(4,5)32-25-24(31-23-15-12-19(29)16-33(23)25)18-10-13-20(14-11-18)35-26(34)21-8-6-7-9-22(21)30/h6-16,32H,17H2,1-5H3 |
| InChIKey | HLLPRBZAXDWZGU-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.46 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|