C28H30ClN3O2 — CID 4659736
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzoate (PubChem CID 4659736) has the molecular formula C28H30ClN3O2 and a molecular weight of 476.02 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzoate |
|---|---|
| PubChem CID | 4659736 |
| Molecular Formula | C28H30ClN3O2 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chlorobenzoate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OC(=O)c2ccc(Cl)cc2)nc2ccccn12 |
| InChI | InChI=1S/C28H30ClN3O2/c1-27(2,3)18-28(4,5)31-25-24(30-23-12-8-9-17-32(23)25)21-10-6-7-11-22(21)34-26(33)19-13-15-20(29)16-14-19/h6-17,31H,18H2,1-5H3 |
| InChIKey | OFAPTKYMMUGIKZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|