C30H35N3O2 — CID 3488130
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylpropanoate (PubChem CID 3488130) has the molecular formula C30H35N3O2 and a molecular weight of 469.63 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylpropanoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylpropanoate |
|---|---|
| PubChem CID | 3488130 |
| Molecular Formula | C30H35N3O2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylpropanoate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OC(=O)CCc2ccccc2)nc2ccccn12 |
| InChI | InChI=1S/C30H35N3O2/c1-29(2,3)21-30(4,5)32-28-27(31-25-17-11-12-20-33(25)28)23-15-9-10-16-24(23)35-26(34)19-18-22-13-7-6-8-14-22/h6-17,20,32H,18-19,21H2,1-5H3 |
| InChIKey | CAOBDVBGPXAFJS-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|