C31H35N3O3 — CID 4266714
[2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate (PubChem CID 4266714) has the molecular formula C31H35N3O3 and a molecular weight of 497.64 g/mol. Its IUPAC name is [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate.
| Compound Name | [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 4266714 |
| Molecular Formula | C31H35N3O3 |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | [2-methoxy-4-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-phenylprop-2-enoate |
| SMILES | COc1cc(-c2nc3ccccn3c2NC(C)(C)CC(C)(C)C)ccc1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C31H35N3O3/c1-30(2,3)21-31(4,5)33-29-28(32-26-14-10-11-19-34(26)29)23-16-17-24(25(20-23)36-6)37-27(35)18-15-22-12-8-7-9-13-22/h7-20,33H,21H2,1-6H3 |
| InChIKey | XBOZVSMLUGZHAD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|