C29H33N3O3 — CID 5111233
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-methoxybenzoate (PubChem CID 5111233) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-methoxybenzoate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 5111233 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 2-methoxybenzoate |
| SMILES | COc1ccccc1C(=O)Oc1ccccc1-c1nc2ccccn2c1NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C29H33N3O3/c1-28(2,3)19-29(4,5)31-26-25(30-24-17-11-12-18-32(24)26)20-13-7-10-16-23(20)35-27(33)21-14-8-9-15-22(21)34-6/h7-18,31H,19H2,1-6H3 |
| InChIKey | GWLUPLSTLBFHPT-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|