C26H29N3O2S — CID 3693521
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 3693521) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3693521 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OC(=O)c2cccs2)nc2ccccn12 |
| InChI | InChI=1S/C26H29N3O2S/c1-25(2,3)17-26(4,5)28-23-22(27-21-14-8-9-15-29(21)23)18-11-6-7-12-19(18)31-24(30)20-13-10-16-32-20/h6-16,28H,17H2,1-5H3 |
| InChIKey | YSGNALIZMVGLCK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|