C25H25N3O3S — CID 3536358
[4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] thiophene-2-carboxylate (PubChem CID 3536358) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] thiophene-2-carboxylate.
| Compound Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 3536358 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] thiophene-2-carboxylate |
| SMILES | COc1cc(-c2nc3ccccn3c2NC2CCCCC2)ccc1OC(=O)c1cccs1 |
| InChI | InChI=1S/C25H25N3O3S/c1-30-20-16-17(12-13-19(20)31-25(29)21-10-7-15-32-21)23-24(26-18-8-3-2-4-9-18)28-14-6-5-11-22(28)27-23/h5-7,10-16,18,26H,2-4,8-9H2,1H3 |
| InChIKey | AAPLKTVDIOTDFY-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|