C28H29N3O4 — CID 3537498
[4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate (PubChem CID 3537498) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate.
| Compound Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 3537498 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2ccc(-c3nc4ccccn4c3NC3CCCCC3)cc2OC)cc1 |
| InChI | InChI=1S/C28H29N3O4/c1-33-22-14-11-19(12-15-22)28(32)35-23-16-13-20(18-24(23)34-2)26-27(29-21-8-4-3-5-9-21)31-17-7-6-10-25(31)30-26/h6-7,10-18,21,29H,3-5,8-9H2,1-2H3 |
| InChIKey | NBMGVFDXQRKXKW-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|