C26H27N3O4 — CID 3916477
[4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] furan-2-carboxylate (PubChem CID 3916477) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] furan-2-carboxylate.
| Compound Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 3916477 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | [4-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] furan-2-carboxylate |
| SMILES | COc1cc(-c2nc3cc(C)ccn3c2NC2CCCCC2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C26H27N3O4/c1-17-12-13-29-23(15-17)28-24(25(29)27-19-7-4-3-5-8-19)18-10-11-20(22(16-18)31-2)33-26(30)21-9-6-14-32-21/h6,9-16,19,27H,3-5,7-8H2,1-2H3 |
| InChIKey | FJEGKCMQMAUKMG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 78.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|