C26H31N3O2 — CID 3295389
[3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] cyclopentanecarboxylate (PubChem CID 3295389) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] cyclopentanecarboxylate.
| Compound Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 3295389 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] cyclopentanecarboxylate |
| SMILES | Cc1ccn2c(NC3CCCCC3)c(-c3cccc(OC(=O)C4CCCC4)c3)nc2c1 |
| InChI | InChI=1S/C26H31N3O2/c1-18-14-15-29-23(16-18)28-24(25(29)27-21-11-3-2-4-12-21)20-10-7-13-22(17-20)31-26(30)19-8-5-6-9-19/h7,10,13-17,19,21,27H,2-6,8-9,11-12H2,1H3 |
| InChIKey | RNLZYQJQXQOMRH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|