C29H33N3O3S — CID 3928909
[3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 3928909) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 3928909 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | Cc1cc(C)c(S(=O)(=O)Oc2cccc(-c3nc4cc(C)ccn4c3NC3CCCCC3)c2)c(C)c1 |
| InChI | InChI=1S/C29H33N3O3S/c1-19-13-14-32-26(17-19)31-27(29(32)30-24-10-6-5-7-11-24)23-9-8-12-25(18-23)35-36(33,34)28-21(3)15-20(2)16-22(28)4/h8-9,12-18,24,30H,5-7,10-11H2,1-4H3 |
| InChIKey | FQCOPPKCEMZAPR-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|