C27H26F3N3O3S — CID 3904263
[2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3904263) has the molecular formula C27H26F3N3O3S and a molecular weight of 529.58 g/mol. Its IUPAC name is [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3904263 |
| Molecular Formula | C27H26F3N3O3S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | [2-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | Cc1ccn2c(NC3CCCCC3)c(-c3ccccc3OS(=O)(=O)c3cccc(C(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C27H26F3N3O3S/c1-18-14-15-33-24(16-18)32-25(26(33)31-20-9-3-2-4-10-20)22-12-5-6-13-23(22)36-37(34,35)21-11-7-8-19(17-21)27(28,29)30/h5-8,11-17,20,31H,2-4,9-10H2,1H3 |
| InChIKey | DWROCSCBSHNRGW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|