C29H26BrN3O3S — CID 4543708
[2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-sulfonate (PubChem CID 4543708) has the molecular formula C29H26BrN3O3S and a molecular weight of 576.52 g/mol. Its IUPAC name is [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-sulfonate.
| Compound Name | [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 4543708 |
| Molecular Formula | C29H26BrN3O3S |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 575.09 |
| IUPAC Name | [2-[6-bromo-3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] naphthalene-2-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1-c1nc2ccc(Br)cn2c1NC1CCCCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H26BrN3O3S/c30-22-15-17-27-32-28(29(33(27)19-22)31-23-10-2-1-3-11-23)25-12-6-7-13-26(25)36-37(34,35)24-16-14-20-8-4-5-9-21(20)18-24/h4-9,12-19,23,31H,1-3,10-11H2 |
| InChIKey | XENAOAVDPZUBQB-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|