C20H22N4O2 — CID 4217109
N-cyclohexyl-7-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 4217109) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is N-cyclohexyl-7-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-cyclohexyl-7-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 4217109 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | N-cyclohexyl-7-methyl-2-(2-nitrophenyl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1ccn2c(NC3CCCCC3)c(-c3ccccc3[N+](=O)[O-])nc2c1 |
| InChI | InChI=1S/C20H22N4O2/c1-14-11-12-23-18(13-14)22-19(16-9-5-6-10-17(16)24(25)26)20(23)21-15-7-3-2-4-8-15/h5-6,9-13,15,21H,2-4,7-8H2,1H3 |
| InChIKey | MBVVPUWXISJMNH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|