C17H18N4O3 — CID 170913656
N-cyclohexyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 170913656) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-cyclohexyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-cyclohexyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 170913656 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-cyclohexyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3ccccn3c2NC2CCCCC2)o1 |
| InChI | InChI=1S/C17H18N4O3/c22-21(23)15-10-9-13(24-15)16-17(18-12-6-2-1-3-7-12)20-11-5-4-8-14(20)19-16/h4-5,8-12,18H,1-3,6-7H2 |
| InChIKey | FKLHSLXFTQBPNO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|