About N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine
N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine (PubChem CID 69339113) has the molecular formula C19H22N4O3
and a molecular weight of 354.41 g/mol. Its IUPAC name is N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 69339113 |
| Molecular Formula | C19H22N4O3 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cc(C)n2c(NC3CCCCC3)c(-c3ccc([N+](=O)[O-])o3)nc2c1 |
| InChI | InChI=1S/C19H22N4O3/c1-12-10-13(2)22-16(11-12)21-18(15-8-9-17(26-15)23(24)25)19(22)20-14-6-4-3-5-7-14/h8-11,14,20H,3-7H2,1-2H3 |
| InChIKey | HEMLZQBZKAYWFM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine?
The IUPAC name of N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine (CID 69339113) is N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine is Cc1cc(C)n2c(NC3CCCCC3)c(-c3ccc([N+](=O)[O-])o3)nc2c1.
What is the InChIKey of N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine?
The InChIKey is HEMLZQBZKAYWFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O3/c1-12-10-13(2)22-16(11-12)21-18(15-8-9-17(26-15)23(24)25)19(22)20-14-6-4-3-5-7-14/h8-11,14,20H,3-7H2,1-2H3.
What are the key properties of N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine?
N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine has a molecular weight of 354.41 g/mol, XLogP of 4.86, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-5,7-dimethyl-2-(5-nitrofuran-2-yl)imidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 69339113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).