C22H25N3S — CID 87782509
N-(cyclohexylmethyl)-2-(3-ethynylthiophen-2-yl)-5,7-dimethylimidazo[1,2-a]pyridin-3-amine (PubChem CID 87782509) has the molecular formula C22H25N3S and a molecular weight of 363.53 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-(3-ethynylthiophen-2-yl)-5,7-dimethylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-2-(3-ethynylthiophen-2-yl)-5,7-dimethylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 87782509 |
| Molecular Formula | C22H25N3S |
| Molecular Weight | 363.53 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-(cyclohexylmethyl)-2-(3-ethynylthiophen-2-yl)-5,7-dimethylimidazo[1,2-a]pyridin-3-amine |
| SMILES | C#Cc1ccsc1-c1nc2cc(C)cc(C)n2c1NCC1CCCCC1 |
| InChI | InChI=1S/C22H25N3S/c1-4-18-10-11-26-21(18)20-22(23-14-17-8-6-5-7-9-17)25-16(3)12-15(2)13-19(25)24-20/h1,10-13,17,23H,5-9,14H2,2-3H3 |
| InChIKey | XHQJHIPRKBINNF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|