C27H29N3O4S — CID 3439834
[3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 3439834) has the molecular formula C27H29N3O4S and a molecular weight of 491.61 g/mol. Its IUPAC name is [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 3439834 |
| Molecular Formula | C27H29N3O4S |
| Molecular Weight | 491.61 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | [3-[3-(cyclohexylamino)-7-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | COc1ccc(S(=O)(=O)Oc2cccc(-c3nc4cc(C)ccn4c3NC3CCCCC3)c2)cc1 |
| InChI | InChI=1S/C27H29N3O4S/c1-19-15-16-30-25(17-19)29-26(27(30)28-21-8-4-3-5-9-21)20-7-6-10-23(18-20)34-35(31,32)24-13-11-22(33-2)12-14-24/h6-7,10-18,21,28H,3-5,8-9H2,1-2H3 |
| InChIKey | FVSCQTPNWIYNFG-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|