C30H41N3O2 — CID 3381984
[3-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-cyclopentylpropanoate (PubChem CID 3381984) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is [3-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-cyclopentylpropanoate.
| Compound Name | [3-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-cyclopentylpropanoate |
|---|---|
| PubChem CID | 3381984 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | [3-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 3-cyclopentylpropanoate |
| SMILES | Cc1ccn2c(NC(C)(C)CC(C)(C)C)c(-c3cccc(OC(=O)CCC4CCCC4)c3)nc2c1 |
| InChI | InChI=1S/C30H41N3O2/c1-21-16-17-33-25(18-21)31-27(28(33)32-30(5,6)20-29(2,3)4)23-12-9-13-24(19-23)35-26(34)15-14-22-10-7-8-11-22/h9,12-13,16-19,22,32H,7-8,10-11,14-15,20H2,1-6H3 |
| InChIKey | TWAIYRXEMUSZQB-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|