C32H37N3O3 — CID 6279426
[2-methoxy-4-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] (E)-3-phenylprop-2-enoate (PubChem CID 6279426) has the molecular formula C32H37N3O3 and a molecular weight of 511.67 g/mol. Its IUPAC name is [2-methoxy-4-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] (E)-3-phenylprop-2-enoate.
| Compound Name | [2-methoxy-4-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 6279426 |
| Molecular Formula | C32H37N3O3 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.28 |
| IUPAC Name | [2-methoxy-4-[7-methyl-3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] (E)-3-phenylprop-2-enoate |
| SMILES | COc1cc(-c2nc3cc(C)ccn3c2NC(C)(C)CC(C)(C)C)ccc1OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C32H37N3O3/c1-22-17-18-35-27(19-22)33-29(30(35)34-32(5,6)21-31(2,3)4)24-14-15-25(26(20-24)37-7)38-28(36)16-13-23-11-9-8-10-12-23/h8-20,34H,21H2,1-7H3/b16-13+ |
| InChIKey | RNVWNLZCHYJOLB-DTQAZKPQSA-N |
| XLogP | 7.56 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|