C24H28ClN3O3 — CID 42743741
[4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-chlorobutanoate (PubChem CID 42743741) has the molecular formula C24H28ClN3O3 and a molecular weight of 441.96 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-chlorobutanoate.
| Compound Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-chlorobutanoate |
|---|---|
| PubChem CID | 42743741 |
| Molecular Formula | C24H28ClN3O3 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]-2-methoxyphenyl] 4-chlorobutanoate |
| SMILES | COc1cc(-c2nc3ccccn3c2NC2CCCCC2)ccc1OC(=O)CCCCl |
| InChI | InChI=1S/C24H28ClN3O3/c1-30-20-16-17(12-13-19(20)31-22(29)11-7-14-25)23-24(26-18-8-3-2-4-9-18)28-15-6-5-10-21(28)27-23/h5-6,10,12-13,15-16,18,26H,2-4,7-9,11,14H2,1H3 |
| InChIKey | BKIMSESHFFJYLG-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|