C24H23N3O2S — CID 4001669
[4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate (PubChem CID 4001669) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate.
| Compound Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 4001669 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | [4-[3-(cyclohexylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] thiophene-2-carboxylate |
| SMILES | O=C(Oc1ccc(-c2nc3ccccn3c2NC2CCCCC2)cc1)c1cccs1 |
| InChI | InChI=1S/C24H23N3O2S/c28-24(20-9-6-16-30-20)29-19-13-11-17(12-14-19)22-23(25-18-7-2-1-3-8-18)27-15-5-4-10-21(27)26-22/h4-6,9-16,18,25H,1-3,7-8H2 |
| InChIKey | AIYLKUFEWYPHOH-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|