C27H29ClN4O5S — CID 3394327
[2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate (PubChem CID 3394327) has the molecular formula C27H29ClN4O5S and a molecular weight of 557.07 g/mol. Its IUPAC name is [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate.
| Compound Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3394327 |
| Molecular Formula | C27H29ClN4O5S |
| Molecular Weight | 557.07 g/mol |
| Exact Mass | 556.15 |
| IUPAC Name | [2-[3-(2,4,4-trimethylpentan-2-ylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-chloro-3-nitrobenzenesulfonate |
| SMILES | CC(C)(C)CC(C)(C)Nc1c(-c2ccccc2OS(=O)(=O)c2ccc(Cl)c([N+](=O)[O-])c2)nc2ccccn12 |
| InChI | InChI=1S/C27H29ClN4O5S/c1-26(2,3)17-27(4,5)30-25-24(29-23-12-8-9-15-31(23)25)19-10-6-7-11-22(19)37-38(35,36)18-13-14-20(28)21(16-18)32(33)34/h6-16,30H,17H2,1-5H3 |
| InChIKey | MBDAUBMRIOPLLH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.07 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|