C31H29N3O2 — CID 42743708
[4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-tert-butylbenzoate (PubChem CID 42743708) has the molecular formula C31H29N3O2 and a molecular weight of 475.59 g/mol. Its IUPAC name is [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-tert-butylbenzoate.
| Compound Name | [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 42743708 |
| Molecular Formula | C31H29N3O2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.23 |
| IUPAC Name | [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)Oc2ccc(-c3nc4ccccn4c3NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H29N3O2/c1-31(2,3)25-16-12-24(13-17-25)30(35)36-26-18-14-23(15-19-26)28-29(32-21-22-9-5-4-6-10-22)34-20-8-7-11-27(34)33-28/h4-20,32H,21H2,1-3H3 |
| InChIKey | HIXSPHFEBXZLSX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|