C29H25N3O2 — CID 3349532
[4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-ethylbenzoate (PubChem CID 3349532) has the molecular formula C29H25N3O2 and a molecular weight of 447.54 g/mol. Its IUPAC name is [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-ethylbenzoate.
| Compound Name | [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-ethylbenzoate |
|---|---|
| PubChem CID | 3349532 |
| Molecular Formula | C29H25N3O2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.19 |
| IUPAC Name | [4-[3-(benzylamino)imidazo[1,2-a]pyridin-2-yl]phenyl] 4-ethylbenzoate |
| SMILES | CCc1ccc(C(=O)Oc2ccc(-c3nc4ccccn4c3NCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C29H25N3O2/c1-2-21-11-13-24(14-12-21)29(33)34-25-17-15-23(16-18-25)27-28(30-20-22-8-4-3-5-9-22)32-19-7-6-10-26(32)31-27/h3-19,30H,2,20H2,1H3 |
| InChIKey | UQXQPKKYOLUFGP-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|