C34H27N3O2 — CID 42743727
[3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-phenylbenzoate (PubChem CID 42743727) has the molecular formula C34H27N3O2 and a molecular weight of 509.61 g/mol. Its IUPAC name is [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-phenylbenzoate.
| Compound Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-phenylbenzoate |
|---|---|
| PubChem CID | 42743727 |
| Molecular Formula | C34H27N3O2 |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | [3-[3-(benzylamino)-8-methylimidazo[1,2-a]pyridin-2-yl]phenyl] 4-phenylbenzoate |
| SMILES | Cc1cccn2c(NCc3ccccc3)c(-c3cccc(OC(=O)c4ccc(-c5ccccc5)cc4)c3)nc12 |
| InChI | InChI=1S/C34H27N3O2/c1-24-10-9-21-37-32(24)36-31(33(37)35-23-25-11-4-2-5-12-25)29-15-8-16-30(22-29)39-34(38)28-19-17-27(18-20-28)26-13-6-3-7-14-26/h2-22,35H,23H2,1H3 |
| InChIKey | SRMHTASJVXSJBJ-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|