C27H22N4O3 — CID 42738330
N-benzyl-2-(4-nitrophenyl)-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine (PubChem CID 42738330) has the molecular formula C27H22N4O3 and a molecular weight of 450.50 g/mol. Its IUPAC name is N-benzyl-2-(4-nitrophenyl)-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-2-(4-nitrophenyl)-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 42738330 |
| Molecular Formula | C27H22N4O3 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-benzyl-2-(4-nitrophenyl)-8-phenylmethoxyimidazo[1,2-a]pyridin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(-c2nc3c(OCc4ccccc4)cccn3c2NCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H22N4O3/c32-31(33)23-15-13-22(14-16-23)25-27(28-18-20-8-3-1-4-9-20)30-17-7-12-24(26(30)29-25)34-19-21-10-5-2-6-11-21/h1-17,28H,18-19H2 |
| InChIKey | USXLQLKTGANJLS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|