C26H22N4O — CID 20952842
N-benzyl-2-(3-phenylmethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine (PubChem CID 20952842) has the molecular formula C26H22N4O and a molecular weight of 406.49 g/mol. Its IUPAC name is N-benzyl-2-(3-phenylmethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine.
| Compound Name | N-benzyl-2-(3-phenylmethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 20952842 |
| Molecular Formula | C26H22N4O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | N-benzyl-2-(3-phenylmethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine |
| SMILES | c1ccc(CNc2c(-c3cccc(OCc4ccccc4)c3)nc3ncccn23)cc1 |
| InChI | InChI=1S/C26H22N4O/c1-3-9-20(10-4-1)18-28-25-24(29-26-27-15-8-16-30(25)26)22-13-7-14-23(17-22)31-19-21-11-5-2-6-12-21/h1-17,28H,18-19H2 |
| InChIKey | MDJZVOXTXMTFDK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |