C21H20N4O2 — CID 42740240
N-benzyl-2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine (PubChem CID 42740240) has the molecular formula C21H20N4O2 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-benzyl-2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine.
| Compound Name | N-benzyl-2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine |
|---|---|
| PubChem CID | 42740240 |
| Molecular Formula | C21H20N4O2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | N-benzyl-2-(2,5-dimethoxyphenyl)imidazo[1,2-a]pyrimidin-3-amine |
| SMILES | COc1ccc(OC)c(-c2nc3ncccn3c2NCc2ccccc2)c1 |
| InChI | InChI=1S/C21H20N4O2/c1-26-16-9-10-18(27-2)17(13-16)19-20(23-14-15-7-4-3-5-8-15)25-12-6-11-22-21(25)24-19/h3-13,23H,14H2,1-2H3 |
| InChIKey | YLURALBIJYDLHR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |