C28H38N2OS — CID 14146321
N,N-dibutyl-5-[4-(2-phenyl-1,3-thiazol-4-yl)phenoxy]pentan-1-amine (PubChem CID 14146321) has the molecular formula C28H38N2OS and a molecular weight of 450.69 g/mol. Its IUPAC name is N,N-dibutyl-5-[4-(2-phenyl-1,3-thiazol-4-yl)phenoxy]pentan-1-amine.
| Compound Name | N,N-dibutyl-5-[4-(2-phenyl-1,3-thiazol-4-yl)phenoxy]pentan-1-amine |
|---|---|
| PubChem CID | 14146321 |
| Molecular Formula | C28H38N2OS |
| Molecular Weight | 450.69 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | N,N-dibutyl-5-[4-(2-phenyl-1,3-thiazol-4-yl)phenoxy]pentan-1-amine |
| SMILES | CCCCN(CCCC)CCCCCOc1ccc(-c2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C28H38N2OS/c1-3-5-19-30(20-6-4-2)21-11-8-12-22-31-26-17-15-24(16-18-26)27-23-32-28(29-27)25-13-9-7-10-14-25/h7,9-10,13-18,23H,3-6,8,11-12,19-22H2,1-2H3 |
| InChIKey | JYOYCUQHJILEQT-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.69 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|