C32H46N2O8S — CID 158984324
N-butyl-N-[3-[4-(5-methoxy-1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid (PubChem CID 158984324) has the molecular formula C32H46N2O8S and a molecular weight of 618.79 g/mol. Its IUPAC name is N-butyl-N-[3-[4-(5-methoxy-1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid.
| Compound Name | N-butyl-N-[3-[4-(5-methoxy-1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid |
|---|---|
| PubChem CID | 158984324 |
| Molecular Formula | C32H46N2O8S |
| Molecular Weight | 618.79 g/mol |
| Exact Mass | 618.30 |
| IUPAC Name | N-butyl-N-[3-[4-(5-methoxy-1-methyl-3-propan-2-ylindol-2-yl)sulfonylphenoxy]propyl]butan-1-amine;oxalic acid |
| SMILES | CCCCN(CCCC)CCCOc1ccc(S(=O)(=O)c2c(C(C)C)c3cc(OC)ccc3n2C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C30H44N2O4S.C2H2O4/c1-7-9-18-32(19-10-8-2)20-11-21-36-24-12-15-26(16-13-24)37(33,34)30-29(23(3)4)27-22-25(35-6)14-17-28(27)31(30)5;3-1(4)2(5)6/h12-17,22-23H,7-11,18-21H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | JPJPSDYXXIAXCM-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.79 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|